C20H19ClF3N4O- — CID 53346658
2-(4-benzylpiperazin-1-yl)-4-(furan-2-yl)-6-(trifluoromethyl)pyrimidine chloride (PubChem CID 53346658) has the molecular formula C20H19ClF3N4O- and a molecular weight of 423.85 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-4-(furan-2-yl)-6-(trifluoromethyl)pyrimidine chloride.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-4-(furan-2-yl)-6-(trifluoromethyl)pyrimidine chloride |
|---|---|
| PubChem CID | 53346658 |
| Molecular Formula | C20H19ClF3N4O- |
| Molecular Weight | 423.85 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-4-(furan-2-yl)-6-(trifluoromethyl)pyrimidine chloride |
| SMILES | FC(F)(F)c1cc(-c2ccco2)nc(N2CCN(Cc3ccccc3)CC2)n1.[Cl-] |
| InChI | InChI=1S/C20H19F3N4O.ClH/c21-20(22,23)18-13-16(17-7-4-12-28-17)24-19(25-18)27-10-8-26(9-11-27)14-15-5-2-1-3-6-15;/h1-7,12-13H,8-11,14H2;1H/p-1 |
| InChIKey | LWNNPEOUXWADOO-UHFFFAOYSA-M |
| XLogP | 1.08 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.85 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |