C20H22N4O2S — CID 23144191
N-[5-(4-benzylpiperazin-1-yl)-4-(furan-2-yl)-1,3-thiazol-2-yl]acetamide (PubChem CID 23144191) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is N-[5-(4-benzylpiperazin-1-yl)-4-(furan-2-yl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-(4-benzylpiperazin-1-yl)-4-(furan-2-yl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 23144191 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-[5-(4-benzylpiperazin-1-yl)-4-(furan-2-yl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(-c2ccco2)c(N2CCN(Cc3ccccc3)CC2)s1 |
| InChI | InChI=1S/C20H22N4O2S/c1-15(25)21-20-22-18(17-8-5-13-26-17)19(27-20)24-11-9-23(10-12-24)14-16-6-3-2-4-7-16/h2-8,13H,9-12,14H2,1H3,(H,21,22,25) |
| InChIKey | OPPCXGWUOZUOKQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |