C17H22ClN5O2S2 — CID 171151142
N-[5-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide;hydrochloride (PubChem CID 171151142) has the molecular formula C17H22ClN5O2S2 and a molecular weight of 427.98 g/mol. Its IUPAC name is N-[5-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide;hydrochloride.
| Compound Name | N-[5-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 171151142 |
| Molecular Formula | C17H22ClN5O2S2 |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | N-[5-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide;hydrochloride |
| SMILES | CC(=O)Nc1nnc(SCC(=O)N2CCN(Cc3ccccc3)CC2)s1.Cl |
| InChI | InChI=1S/C17H21N5O2S2.ClH/c1-13(23)18-16-19-20-17(26-16)25-12-15(24)22-9-7-21(8-10-22)11-14-5-3-2-4-6-14;/h2-6H,7-12H2,1H3,(H,18,19,23);1H |
| InChIKey | HQEHUYGCMUYFEK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|