C18H26N6OS — CID 9379248
1-(4-benzylpiperazin-1-yl)-2-(1-tert-butyltetrazol-5-yl)sulfanylethanone (PubChem CID 9379248) has the molecular formula C18H26N6OS and a molecular weight of 374.51 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-2-(1-tert-butyltetrazol-5-yl)sulfanylethanone.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-2-(1-tert-butyltetrazol-5-yl)sulfanylethanone |
|---|---|
| PubChem CID | 9379248 |
| Molecular Formula | C18H26N6OS |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-2-(1-tert-butyltetrazol-5-yl)sulfanylethanone |
| SMILES | CC(C)(C)n1nnnc1SCC(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H26N6OS/c1-18(2,3)24-17(19-20-21-24)26-14-16(25)23-11-9-22(10-12-23)13-15-7-5-4-6-8-15/h4-8H,9-14H2,1-3H3 |
| InChIKey | WVPIZTWKPMGILN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |