C23H22ClN5O2S2 — CID 3990328
N-[5-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-phenylprop-2-enamide (PubChem CID 3990328) has the molecular formula C23H22ClN5O2S2 and a molecular weight of 500.05 g/mol. Its IUPAC name is N-[5-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-phenylprop-2-enamide.
| Compound Name | N-[5-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 3990328 |
| Molecular Formula | C23H22ClN5O2S2 |
| Molecular Weight | 500.05 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | N-[5-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-phenylprop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1)Nc1nnc(SCC(=O)N2CCN(c3ccc(Cl)cc3)CC2)s1 |
| InChI | InChI=1S/C23H22ClN5O2S2/c24-18-7-9-19(10-8-18)28-12-14-29(15-13-28)21(31)16-32-23-27-26-22(33-23)25-20(30)11-6-17-4-2-1-3-5-17/h1-11H,12-16H2,(H,25,26,30) |
| InChIKey | YLXLLVGYYVNYPE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.05 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|