C18H14ClN3OS2 — CID 6272121
(E)-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-phenylprop-2-enamide (PubChem CID 6272121) has the molecular formula C18H14ClN3OS2 and a molecular weight of 387.92 g/mol. Its IUPAC name is (E)-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 6272121 |
| Molecular Formula | C18H14ClN3OS2 |
| Molecular Weight | 387.92 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | (E)-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)Nc1nnc(SCc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C18H14ClN3OS2/c19-15-9-6-14(7-10-15)12-24-18-22-21-17(25-18)20-16(23)11-8-13-4-2-1-3-5-13/h1-11H,12H2,(H,20,21,23)/b11-8+ |
| InChIKey | XEEVMIBMBPHKJN-DHZHZOJOSA-N |
| XLogP | 5.14 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.92 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|