C25H20N4O2S2 — CID 3997931
N-phenyl-4-[[5-(3-phenylprop-2-enoylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzamide (PubChem CID 3997931) has the molecular formula C25H20N4O2S2 and a molecular weight of 472.60 g/mol. Its IUPAC name is N-phenyl-4-[[5-(3-phenylprop-2-enoylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzamide.
| Compound Name | N-phenyl-4-[[5-(3-phenylprop-2-enoylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 3997931 |
| Molecular Formula | C25H20N4O2S2 |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | N-phenyl-4-[[5-(3-phenylprop-2-enoylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzamide |
| SMILES | O=C(C=Cc1ccccc1)Nc1nnc(SCc2ccc(C(=O)Nc3ccccc3)cc2)s1 |
| InChI | InChI=1S/C25H20N4O2S2/c30-22(16-13-18-7-3-1-4-8-18)27-24-28-29-25(33-24)32-17-19-11-14-20(15-12-19)23(31)26-21-9-5-2-6-10-21/h1-16H,17H2,(H,26,31)(H,27,28,30) |
| InChIKey | PNEGIUYEWQNXLH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|