C27H24N4O2S2 — CID 5032222
N-(2,4-dimethylphenyl)-4-[[5-(3-phenylprop-2-enoylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzamide (PubChem CID 5032222) has the molecular formula C27H24N4O2S2 and a molecular weight of 500.65 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-4-[[5-(3-phenylprop-2-enoylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzamide.
| Compound Name | N-(2,4-dimethylphenyl)-4-[[5-(3-phenylprop-2-enoylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 5032222 |
| Molecular Formula | C27H24N4O2S2 |
| Molecular Weight | 500.65 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | N-(2,4-dimethylphenyl)-4-[[5-(3-phenylprop-2-enoylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(CSc3nnc(NC(=O)C=Cc4ccccc4)s3)cc2)c(C)c1 |
| InChI | InChI=1S/C27H24N4O2S2/c1-18-8-14-23(19(2)16-18)28-25(33)22-12-9-21(10-13-22)17-34-27-31-30-26(35-27)29-24(32)15-11-20-6-4-3-5-7-20/h3-16H,17H2,1-2H3,(H,28,33)(H,29,30,32) |
| InChIKey | HXQKOJGCAQLHGL-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.65 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|