C23H25N3OS2 — CID 18864414
(E)-3-(4-tert-butylphenyl)-N-[5-[(3-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 18864414) has the molecular formula C23H25N3OS2 and a molecular weight of 423.61 g/mol. Its IUPAC name is (E)-3-(4-tert-butylphenyl)-N-[5-[(3-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(4-tert-butylphenyl)-N-[5-[(3-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 18864414 |
| Molecular Formula | C23H25N3OS2 |
| Molecular Weight | 423.61 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | (E)-3-(4-tert-butylphenyl)-N-[5-[(3-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | Cc1cccc(CSc2nnc(NC(=O)/C=C/c3ccc(C(C)(C)C)cc3)s2)c1 |
| InChI | InChI=1S/C23H25N3OS2/c1-16-6-5-7-18(14-16)15-28-22-26-25-21(29-22)24-20(27)13-10-17-8-11-19(12-9-17)23(2,3)4/h5-14H,15H2,1-4H3,(H,24,25,27)/b13-10+ |
| InChIKey | TWGOMKJIIPKKJD-JLHYYAGUSA-N |
| XLogP | 6.09 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.61 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|