C16H14N4OS2 — CID 7760139
4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-N-phenylbenzamide (PubChem CID 7760139) has the molecular formula C16H14N4OS2 and a molecular weight of 342.45 g/mol. Its IUPAC name is 4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-N-phenylbenzamide.
| Compound Name | 4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 7760139 |
| Molecular Formula | C16H14N4OS2 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-N-phenylbenzamide |
| SMILES | Nc1nnc(SCc2ccc(C(=O)Nc3ccccc3)cc2)s1 |
| InChI | InChI=1S/C16H14N4OS2/c17-15-19-20-16(23-15)22-10-11-6-8-12(9-7-11)14(21)18-13-4-2-1-3-5-13/h1-9H,10H2,(H2,17,19)(H,18,21) |
| InChIKey | ANSDOBFMAZRYRJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |