C20H21N5O2S2 — CID 72713921
4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-N-(4-morpholin-4-ylphenyl)benzamide (PubChem CID 72713921) has the molecular formula C20H21N5O2S2 and a molecular weight of 427.56 g/mol. Its IUPAC name is 4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-N-(4-morpholin-4-ylphenyl)benzamide.
| Compound Name | 4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-N-(4-morpholin-4-ylphenyl)benzamide |
|---|---|
| PubChem CID | 72713921 |
| Molecular Formula | C20H21N5O2S2 |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-N-(4-morpholin-4-ylphenyl)benzamide |
| SMILES | Nc1nnc(SCc2ccc(C(=O)Nc3ccc(N4CCOCC4)cc3)cc2)s1 |
| InChI | InChI=1S/C20H21N5O2S2/c21-19-23-24-20(29-19)28-13-14-1-3-15(4-2-14)18(26)22-16-5-7-17(8-6-16)25-9-11-27-12-10-25/h1-8H,9-13H2,(H2,21,23)(H,22,26) |
| InChIKey | WZHJZUYTFOIGLI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|