C10H8N3O2S2- — CID 7065834
4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]benzoate (PubChem CID 7065834) has the molecular formula C10H8N3O2S2- and a molecular weight of 266.33 g/mol. Its IUPAC name is 4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]benzoate.
| Compound Name | 4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 7065834 |
| Molecular Formula | C10H8N3O2S2- |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]benzoate |
| SMILES | Nc1nnc(SCc2ccc(C(=O)[O-])cc2)s1 |
| InChI | InChI=1S/C10H9N3O2S2/c11-9-12-13-10(17-9)16-5-6-1-3-7(4-2-6)8(14)15/h1-4H,5H2,(H2,11,12)(H,14,15)/p-1 |
| InChIKey | QJKNFSPAYVEYDX-UHFFFAOYSA-M |
| XLogP | 0.78 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |