About 5-(furan-3-ylmethylsulfanyl)-1,3,4-thiadiazol-2-amine
5-(furan-3-ylmethylsulfanyl)-1,3,4-thiadiazol-2-amine (PubChem CID 83172117) has the molecular formula C7H7N3OS2
and a molecular weight of 213.29 g/mol. Its IUPAC name is 5-(furan-3-ylmethylsulfanyl)-1,3,4-thiadiazol-2-amine.
Analyze 5-(furan-3-ylmethylsulfanyl)-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(furan-3-ylmethylsulfanyl)-1,3,4-thiadiazol-2-amine?
The IUPAC name of 5-(furan-3-ylmethylsulfanyl)-1,3,4-thiadiazol-2-amine (CID 83172117) is 5-(furan-3-ylmethylsulfanyl)-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for 5-(furan-3-ylmethylsulfanyl)-1,3,4-thiadiazol-2-amine?
The canonical SMILES for 5-(furan-3-ylmethylsulfanyl)-1,3,4-thiadiazol-2-amine is Nc1nnc(SCc2ccoc2)s1.
What is the InChIKey of 5-(furan-3-ylmethylsulfanyl)-1,3,4-thiadiazol-2-amine?
The InChIKey is UGAGOJIKMRBIMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3OS2/c8-6-9-10-7(13-6)12-4-5-1-2-11-3-5/h1-3H,4H2,(H2,8,9).
What are the key properties of 5-(furan-3-ylmethylsulfanyl)-1,3,4-thiadiazol-2-amine?
5-(furan-3-ylmethylsulfanyl)-1,3,4-thiadiazol-2-amine has a molecular weight of 213.29 g/mol, XLogP of 2.01, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(furan-3-ylmethylsulfanyl)-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 83172117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).