C8H7N3OS3 — CID 9430122
4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]thiophene-2-carbaldehyde (PubChem CID 9430122) has the molecular formula C8H7N3OS3 and a molecular weight of 257.36 g/mol. Its IUPAC name is 4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]thiophene-2-carbaldehyde.
| Compound Name | 4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 9430122 |
| Molecular Formula | C8H7N3OS3 |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 256.98 |
| IUPAC Name | 4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]thiophene-2-carbaldehyde |
| SMILES | Nc1nnc(SCc2csc(C=O)c2)s1 |
| InChI | InChI=1S/C8H7N3OS3/c9-7-10-11-8(15-7)14-4-5-1-6(2-12)13-3-5/h1-3H,4H2,(H2,9,10) |
| InChIKey | JCCCHMJEHOSYNG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|