C10H10N4O3S2 — CID 81154925
5-[(3-methoxy-5-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-amine (PubChem CID 81154925) has the molecular formula C10H10N4O3S2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 5-[(3-methoxy-5-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[(3-methoxy-5-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 81154925 |
| Molecular Formula | C10H10N4O3S2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 5-[(3-methoxy-5-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-amine |
| SMILES | COc1cc(CSc2nnc(N)s2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H10N4O3S2/c1-17-8-3-6(2-7(4-8)14(15)16)5-18-10-13-12-9(11)19-10/h2-4H,5H2,1H3,(H2,11,12) |
| InChIKey | KVEKAVVJOHELRP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 104.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|