C13H11N3O3S2 — CID 8633172
4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-7-methoxychromen-2-one (PubChem CID 8633172) has the molecular formula C13H11N3O3S2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-7-methoxychromen-2-one.
| Compound Name | 4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 8633172 |
| Molecular Formula | C13H11N3O3S2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-7-methoxychromen-2-one |
| SMILES | COc1ccc2c(CSc3nnc(N)s3)cc(=O)oc2c1 |
| InChI | InChI=1S/C13H11N3O3S2/c1-18-8-2-3-9-7(4-11(17)19-10(9)5-8)6-20-13-16-15-12(14)21-13/h2-5H,6H2,1H3,(H2,14,15) |
| InChIKey | MUAZGIPCWWKZKK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|