C14H12BrN3O2S2 — CID 27987494
7-bromo-4-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]chromen-2-one (PubChem CID 27987494) has the molecular formula C14H12BrN3O2S2 and a molecular weight of 398.31 g/mol. Its IUPAC name is 7-bromo-4-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]chromen-2-one.
| Compound Name | 7-bromo-4-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]chromen-2-one |
|---|---|
| PubChem CID | 27987494 |
| Molecular Formula | C14H12BrN3O2S2 |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 396.96 |
| IUPAC Name | 7-bromo-4-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]chromen-2-one |
| SMILES | CCNc1nnc(SCc2cc(=O)oc3cc(Br)ccc23)s1 |
| InChI | InChI=1S/C14H12BrN3O2S2/c1-2-16-13-17-18-14(22-13)21-7-8-5-12(19)20-11-6-9(15)3-4-10(8)11/h3-6H,2,7H2,1H3,(H,16,17) |
| InChIKey | RPZCZUJOHXAZCF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|