C14H10BrN3O2S — CID 106678595
4-[(3-aminopyrazin-2-yl)sulfanylmethyl]-7-bromochromen-2-one (PubChem CID 106678595) has the molecular formula C14H10BrN3O2S and a molecular weight of 364.22 g/mol. Its IUPAC name is 4-[(3-aminopyrazin-2-yl)sulfanylmethyl]-7-bromochromen-2-one.
| Compound Name | 4-[(3-aminopyrazin-2-yl)sulfanylmethyl]-7-bromochromen-2-one |
|---|---|
| PubChem CID | 106678595 |
| Molecular Formula | C14H10BrN3O2S |
| Molecular Weight | 364.22 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | 4-[(3-aminopyrazin-2-yl)sulfanylmethyl]-7-bromochromen-2-one |
| SMILES | Nc1nccnc1SCc1cc(=O)oc2cc(Br)ccc12 |
| InChI | InChI=1S/C14H10BrN3O2S/c15-9-1-2-10-8(5-12(19)20-11(10)6-9)7-21-14-13(16)17-3-4-18-14/h1-6H,7H2,(H2,16,17) |
| InChIKey | CDGNPLBIQMTTCP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.22 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|