C13H10BrN3O3S — CID 102630516
4-[[5-(aminomethyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-7-bromochromen-2-one (PubChem CID 102630516) has the molecular formula C13H10BrN3O3S and a molecular weight of 368.21 g/mol. Its IUPAC name is 4-[[5-(aminomethyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-7-bromochromen-2-one.
| Compound Name | 4-[[5-(aminomethyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-7-bromochromen-2-one |
|---|---|
| PubChem CID | 102630516 |
| Molecular Formula | C13H10BrN3O3S |
| Molecular Weight | 368.21 g/mol |
| Exact Mass | 366.96 |
| IUPAC Name | 4-[[5-(aminomethyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-7-bromochromen-2-one |
| SMILES | NCc1nnc(SCc2cc(=O)oc3cc(Br)ccc23)o1 |
| InChI | InChI=1S/C13H10BrN3O3S/c14-8-1-2-9-7(3-12(18)19-10(9)4-8)6-21-13-17-16-11(5-15)20-13/h1-4H,5-6,15H2 |
| InChIKey | DYPMKYCTSUFGRI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.21 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|