C16H14BrN3O2S — CID 30400025
7-bromo-4-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]chromen-2-one (PubChem CID 30400025) has the molecular formula C16H14BrN3O2S and a molecular weight of 392.28 g/mol. Its IUPAC name is 7-bromo-4-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]chromen-2-one.
| Compound Name | 7-bromo-4-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]chromen-2-one |
|---|---|
| PubChem CID | 30400025 |
| Molecular Formula | C16H14BrN3O2S |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | 7-bromo-4-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]chromen-2-one |
| SMILES | C=CCn1c(C)nnc1SCc1cc(=O)oc2cc(Br)ccc12 |
| InChI | InChI=1S/C16H14BrN3O2S/c1-3-6-20-10(2)18-19-16(20)23-9-11-7-15(21)22-14-8-12(17)4-5-13(11)14/h3-5,7-8H,1,6,9H2,2H3 |
| InChIKey | BJFOVVQYQGQALF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|