C22H21N3O2S — CID 2404460
4-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-7-ethylchromen-2-one (PubChem CID 2404460) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is 4-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-7-ethylchromen-2-one.
| Compound Name | 4-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-7-ethylchromen-2-one |
|---|---|
| PubChem CID | 2404460 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 4-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-7-ethylchromen-2-one |
| SMILES | CCc1ccc2c(CSc3nnc(C)n3Cc3ccccc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H21N3O2S/c1-3-16-9-10-19-18(12-21(26)27-20(19)11-16)14-28-22-24-23-15(2)25(22)13-17-7-5-4-6-8-17/h4-12H,3,13-14H2,1-2H3 |
| InChIKey | QAGBRFPPVMPXFA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|