C19H17N3O3S — CID 18132864
7-ethyl-4-[[4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]chromen-2-one (PubChem CID 18132864) has the molecular formula C19H17N3O3S and a molecular weight of 367.43 g/mol. Its IUPAC name is 7-ethyl-4-[[4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]chromen-2-one.
| Compound Name | 7-ethyl-4-[[4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]chromen-2-one |
|---|---|
| PubChem CID | 18132864 |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 7-ethyl-4-[[4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]chromen-2-one |
| SMILES | CCc1ccc2c(CSc3nncn3Cc3ccco3)cc(=O)oc2c1 |
| InChI | InChI=1S/C19H17N3O3S/c1-2-13-5-6-16-14(9-18(23)25-17(16)8-13)11-26-19-21-20-12-22(19)10-15-4-3-7-24-15/h3-9,12H,2,10-11H2,1H3 |
| InChIKey | PAVKJLDHFRGAMO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|