C26H23N3O3S — CID 47094097
4-[[4-benzyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-ethylchromen-2-one (PubChem CID 47094097) has the molecular formula C26H23N3O3S and a molecular weight of 457.56 g/mol. Its IUPAC name is 4-[[4-benzyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-ethylchromen-2-one.
| Compound Name | 4-[[4-benzyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-ethylchromen-2-one |
|---|---|
| PubChem CID | 47094097 |
| Molecular Formula | C26H23N3O3S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 4-[[4-benzyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-ethylchromen-2-one |
| SMILES | CCc1ccc2c(CSc3nnc(-c4ccoc4C)n3Cc3ccccc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C26H23N3O3S/c1-3-18-9-10-22-20(14-24(30)32-23(22)13-18)16-33-26-28-27-25(21-11-12-31-17(21)2)29(26)15-19-7-5-4-6-8-19/h4-14H,3,15-16H2,1-2H3 |
| InChIKey | QPSJWECDLYPYLW-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|