C19H18N4O3S — CID 29388495
4-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-6,7-dimethylchromen-2-one (PubChem CID 29388495) has the molecular formula C19H18N4O3S and a molecular weight of 382.45 g/mol. Its IUPAC name is 4-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-6,7-dimethylchromen-2-one.
| Compound Name | 4-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-6,7-dimethylchromen-2-one |
|---|---|
| PubChem CID | 29388495 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 4-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-6,7-dimethylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CSc3nnc(-c4ccoc4C)n3N)c2cc1C |
| InChI | InChI=1S/C19H18N4O3S/c1-10-6-15-13(8-17(24)26-16(15)7-11(10)2)9-27-19-22-21-18(23(19)20)14-4-5-25-12(14)3/h4-8H,9,20H2,1-3H3 |
| InChIKey | CBKRWBSDFRHXLX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 100.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|