C20H16Cl2N4O2S — CID 3654323
4-[[4-amino-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one (PubChem CID 3654323) has the molecular formula C20H16Cl2N4O2S and a molecular weight of 447.35 g/mol. Its IUPAC name is 4-[[4-amino-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one.
| Compound Name | 4-[[4-amino-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 3654323 |
| Molecular Formula | C20H16Cl2N4O2S |
| Molecular Weight | 447.35 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | 4-[[4-amino-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one |
| SMILES | Cc1ccc2c(CSc3nnc(-c4ccc(Cl)cc4Cl)n3N)cc(=O)oc2c1C |
| InChI | InChI=1S/C20H16Cl2N4O2S/c1-10-3-5-14-12(7-17(27)28-18(14)11(10)2)9-29-20-25-24-19(26(20)23)15-6-4-13(21)8-16(15)22/h3-8H,9,23H2,1-2H3 |
| InChIKey | ILDYAGXTJWFBLF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.35 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|