C28H24FN3O2S — CID 4283685
4-[[5-(2-fluorophenyl)-4-(2-phenylethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one (PubChem CID 4283685) has the molecular formula C28H24FN3O2S and a molecular weight of 485.58 g/mol. Its IUPAC name is 4-[[5-(2-fluorophenyl)-4-(2-phenylethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one.
| Compound Name | 4-[[5-(2-fluorophenyl)-4-(2-phenylethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 4283685 |
| Molecular Formula | C28H24FN3O2S |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 4-[[5-(2-fluorophenyl)-4-(2-phenylethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one |
| SMILES | Cc1ccc2c(CSc3nnc(-c4ccccc4F)n3CCc3ccccc3)cc(=O)oc2c1C |
| InChI | InChI=1S/C28H24FN3O2S/c1-18-12-13-22-21(16-25(33)34-26(22)19(18)2)17-35-28-31-30-27(23-10-6-7-11-24(23)29)32(28)15-14-20-8-4-3-5-9-20/h3-13,16H,14-15,17H2,1-2H3 |
| InChIKey | XXPFJEAASLTGDT-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|