C22H20N4O2S — CID 4814265
7,8-dimethyl-4-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]chromen-2-one (PubChem CID 4814265) has the molecular formula C22H20N4O2S and a molecular weight of 404.50 g/mol. Its IUPAC name is 7,8-dimethyl-4-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]chromen-2-one.
| Compound Name | 7,8-dimethyl-4-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]chromen-2-one |
|---|---|
| PubChem CID | 4814265 |
| Molecular Formula | C22H20N4O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 7,8-dimethyl-4-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]chromen-2-one |
| SMILES | C=CCn1c(SCc2cc(=O)oc3c(C)c(C)ccc23)nnc1-c1ccncc1 |
| InChI | InChI=1S/C22H20N4O2S/c1-4-11-26-21(16-7-9-23-10-8-16)24-25-22(26)29-13-17-12-19(27)28-20-15(3)14(2)5-6-18(17)20/h4-10,12H,1,11,13H2,2-3H3 |
| InChIKey | SJAJCIQVSOMQQE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|