C21H16FN3O3S — CID 7876388
4-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-7-hydroxychromen-2-one (PubChem CID 7876388) has the molecular formula C21H16FN3O3S and a molecular weight of 409.44 g/mol. Its IUPAC name is 4-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-7-hydroxychromen-2-one.
| Compound Name | 4-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-7-hydroxychromen-2-one |
|---|---|
| PubChem CID | 7876388 |
| Molecular Formula | C21H16FN3O3S |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 4-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-7-hydroxychromen-2-one |
| SMILES | C=CCn1c(SCc2cc(=O)oc3cc(O)ccc23)nnc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H16FN3O3S/c1-2-9-25-20(13-3-5-15(22)6-4-13)23-24-21(25)29-12-14-10-19(27)28-18-11-16(26)7-8-17(14)18/h2-8,10-11,26H,1,9,12H2 |
| InChIKey | OACASBYJOZGDCH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|