C20H17FN4O2S — CID 7989534
4-[[4-amino-5-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-ethylchromen-2-one (PubChem CID 7989534) has the molecular formula C20H17FN4O2S and a molecular weight of 396.45 g/mol. Its IUPAC name is 4-[[4-amino-5-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-ethylchromen-2-one.
| Compound Name | 4-[[4-amino-5-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-ethylchromen-2-one |
|---|---|
| PubChem CID | 7989534 |
| Molecular Formula | C20H17FN4O2S |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 4-[[4-amino-5-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-ethylchromen-2-one |
| SMILES | CCc1ccc2c(CSc3nnc(-c4ccc(F)cc4)n3N)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H17FN4O2S/c1-2-12-3-8-16-14(10-18(26)27-17(16)9-12)11-28-20-24-23-19(25(20)22)13-4-6-15(21)7-5-13/h3-10H,2,11,22H2,1H3 |
| InChIKey | GOFBGXXOUIGKCJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|