C22H20ClN3O2S — CID 18282850
4-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanylmethyl]-6,7-dimethylchromen-2-one (PubChem CID 18282850) has the molecular formula C22H20ClN3O2S and a molecular weight of 425.94 g/mol. Its IUPAC name is 4-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanylmethyl]-6,7-dimethylchromen-2-one.
| Compound Name | 4-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanylmethyl]-6,7-dimethylchromen-2-one |
|---|---|
| PubChem CID | 18282850 |
| Molecular Formula | C22H20ClN3O2S |
| Molecular Weight | 425.94 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 4-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanylmethyl]-6,7-dimethylchromen-2-one |
| SMILES | CCn1c(SCc2cc(=O)oc3cc(C)c(C)cc23)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H20ClN3O2S/c1-4-26-21(15-5-7-17(23)8-6-15)24-25-22(26)29-12-16-11-20(27)28-19-10-14(3)13(2)9-18(16)19/h5-11H,4,12H2,1-3H3 |
| InChIKey | IDNABGRCWNBQKE-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.94 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|