C19H21ClN4O3S — CID 8838368
6-chloro-4-[(4-ethyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-7-methylchromen-2-one (PubChem CID 8838368) has the molecular formula C19H21ClN4O3S and a molecular weight of 420.92 g/mol. Its IUPAC name is 6-chloro-4-[(4-ethyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-7-methylchromen-2-one.
| Compound Name | 6-chloro-4-[(4-ethyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-7-methylchromen-2-one |
|---|---|
| PubChem CID | 8838368 |
| Molecular Formula | C19H21ClN4O3S |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 6-chloro-4-[(4-ethyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-7-methylchromen-2-one |
| SMILES | CCn1c(SCc2cc(=O)oc3cc(C)c(Cl)cc23)nnc1N1CCOCC1 |
| InChI | InChI=1S/C19H21ClN4O3S/c1-3-24-18(23-4-6-26-7-5-23)21-22-19(24)28-11-13-9-17(25)27-16-8-12(2)15(20)10-14(13)16/h8-10H,3-7,11H2,1-2H3 |
| InChIKey | LJLDDFVIZVTWPK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 73.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|