C24H30N4O3S — CID 24591562
6,7-dimethyl-4-[[4-(oxolan-2-ylmethyl)-5-piperidin-1-yl-1,2,4-triazol-3-yl]sulfanylmethyl]chromen-2-one (PubChem CID 24591562) has the molecular formula C24H30N4O3S and a molecular weight of 454.60 g/mol. Its IUPAC name is 6,7-dimethyl-4-[[4-(oxolan-2-ylmethyl)-5-piperidin-1-yl-1,2,4-triazol-3-yl]sulfanylmethyl]chromen-2-one.
| Compound Name | 6,7-dimethyl-4-[[4-(oxolan-2-ylmethyl)-5-piperidin-1-yl-1,2,4-triazol-3-yl]sulfanylmethyl]chromen-2-one |
|---|---|
| PubChem CID | 24591562 |
| Molecular Formula | C24H30N4O3S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 6,7-dimethyl-4-[[4-(oxolan-2-ylmethyl)-5-piperidin-1-yl-1,2,4-triazol-3-yl]sulfanylmethyl]chromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CSc3nnc(N4CCCCC4)n3CC3CCCO3)c2cc1C |
| InChI | InChI=1S/C24H30N4O3S/c1-16-11-20-18(13-22(29)31-21(20)12-17(16)2)15-32-24-26-25-23(27-8-4-3-5-9-27)28(24)14-19-7-6-10-30-19/h11-13,19H,3-10,14-15H2,1-2H3 |
| InChIKey | BVXKRYFZWNFYBY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 73.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|