C17H12ClN3O2S — CID 7558337
6-chloro-7-methyl-4-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)chromen-2-one (PubChem CID 7558337) has the molecular formula C17H12ClN3O2S and a molecular weight of 357.82 g/mol. Its IUPAC name is 6-chloro-7-methyl-4-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)chromen-2-one.
| Compound Name | 6-chloro-7-methyl-4-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)chromen-2-one |
|---|---|
| PubChem CID | 7558337 |
| Molecular Formula | C17H12ClN3O2S |
| Molecular Weight | 357.82 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 6-chloro-7-methyl-4-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)chromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CSc3nnc4ccccn34)c2cc1Cl |
| InChI | InChI=1S/C17H12ClN3O2S/c1-10-6-14-12(8-13(10)18)11(7-16(22)23-14)9-24-17-20-19-15-4-2-3-5-21(15)17/h2-8H,9H2,1H3 |
| InChIKey | GQVNHPSMGSXXGY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 60.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.82 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|