C20H19N3O2S2 — CID 4815255
4-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-6,7-dimethylchromen-2-one (PubChem CID 4815255) has the molecular formula C20H19N3O2S2 and a molecular weight of 397.53 g/mol. Its IUPAC name is 4-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-6,7-dimethylchromen-2-one.
| Compound Name | 4-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-6,7-dimethylchromen-2-one |
|---|---|
| PubChem CID | 4815255 |
| Molecular Formula | C20H19N3O2S2 |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 4-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-6,7-dimethylchromen-2-one |
| SMILES | CCn1c(SCc2cc(=O)oc3cc(C)c(C)cc23)nnc1-c1cccs1 |
| InChI | InChI=1S/C20H19N3O2S2/c1-4-23-19(17-6-5-7-26-17)21-22-20(23)27-11-14-10-18(24)25-16-9-13(3)12(2)8-15(14)16/h5-10H,4,11H2,1-3H3 |
| InChIKey | LQAAYVLNQVSLQK-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|