C23H23N3O2S — CID 112782028
4-[[4-ethyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one (PubChem CID 112782028) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is 4-[[4-ethyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one.
| Compound Name | 4-[[4-ethyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 112782028 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 4-[[4-ethyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one |
| SMILES | CCn1c(SCc2cc(=O)oc3c(C)c(C)ccc23)nnc1-c1cccc(C)c1 |
| InChI | InChI=1S/C23H23N3O2S/c1-5-26-22(17-8-6-7-14(2)11-17)24-25-23(26)29-13-18-12-20(27)28-21-16(4)15(3)9-10-19(18)21/h6-12H,5,13H2,1-4H3 |
| InChIKey | ASXLDBJBAFCTAX-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|