C20H15N3O2S2 — CID 2612746
7,8-dimethyl-4-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanylmethyl)chromen-2-one (PubChem CID 2612746) has the molecular formula C20H15N3O2S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 7,8-dimethyl-4-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanylmethyl)chromen-2-one.
| Compound Name | 7,8-dimethyl-4-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanylmethyl)chromen-2-one |
|---|---|
| PubChem CID | 2612746 |
| Molecular Formula | C20H15N3O2S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 7,8-dimethyl-4-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanylmethyl)chromen-2-one |
| SMILES | Cc1ccc2c(CSc3nnc4sc5ccccc5n34)cc(=O)oc2c1C |
| InChI | InChI=1S/C20H15N3O2S2/c1-11-7-8-14-13(9-17(24)25-18(14)12(11)2)10-26-19-21-22-20-23(19)15-5-3-4-6-16(15)27-20/h3-9H,10H2,1-2H3 |
| InChIKey | NPMVDSZDUUTMFQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 60.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|