C27H24N2O3S — CID 3384363
4-[[1-(4-ethoxyphenyl)benzimidazol-2-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one (PubChem CID 3384363) has the molecular formula C27H24N2O3S and a molecular weight of 456.57 g/mol. Its IUPAC name is 4-[[1-(4-ethoxyphenyl)benzimidazol-2-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one.
| Compound Name | 4-[[1-(4-ethoxyphenyl)benzimidazol-2-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 3384363 |
| Molecular Formula | C27H24N2O3S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 4-[[1-(4-ethoxyphenyl)benzimidazol-2-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one |
| SMILES | CCOc1ccc(-n2c(SCc3cc(=O)oc4c(C)c(C)ccc34)nc3ccccc32)cc1 |
| InChI | InChI=1S/C27H24N2O3S/c1-4-31-21-12-10-20(11-13-21)29-24-8-6-5-7-23(24)28-27(29)33-16-19-15-25(30)32-26-18(3)17(2)9-14-22(19)26/h5-15H,4,16H2,1-3H3 |
| InChIKey | UTNWNBJMPSWDSL-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|