C27H21F3N2O2S — CID 3582307
4-[[1-benzyl-5-(trifluoromethyl)benzimidazol-2-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one (PubChem CID 3582307) has the molecular formula C27H21F3N2O2S and a molecular weight of 494.54 g/mol. Its IUPAC name is 4-[[1-benzyl-5-(trifluoromethyl)benzimidazol-2-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one.
| Compound Name | 4-[[1-benzyl-5-(trifluoromethyl)benzimidazol-2-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 3582307 |
| Molecular Formula | C27H21F3N2O2S |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | 4-[[1-benzyl-5-(trifluoromethyl)benzimidazol-2-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one |
| SMILES | Cc1ccc2c(CSc3nc4cc(C(F)(F)F)ccc4n3Cc3ccccc3)cc(=O)oc2c1C |
| InChI | InChI=1S/C27H21F3N2O2S/c1-16-8-10-21-19(12-24(33)34-25(21)17(16)2)15-35-26-31-22-13-20(27(28,29)30)9-11-23(22)32(26)14-18-6-4-3-5-7-18/h3-13H,14-15H2,1-2H3 |
| InChIKey | HDVLRNULRQEOFV-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|