C17H14F3N3O2S — CID 177370204
2-[1-benzyl-5-(trifluoromethyl)benzimidazol-2-yl]sulfanyl-N-hydroxyacetamide (PubChem CID 177370204) has the molecular formula C17H14F3N3O2S and a molecular weight of 381.38 g/mol. Its IUPAC name is 2-[1-benzyl-5-(trifluoromethyl)benzimidazol-2-yl]sulfanyl-N-hydroxyacetamide.
| Compound Name | 2-[1-benzyl-5-(trifluoromethyl)benzimidazol-2-yl]sulfanyl-N-hydroxyacetamide |
|---|---|
| PubChem CID | 177370204 |
| Molecular Formula | C17H14F3N3O2S |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 2-[1-benzyl-5-(trifluoromethyl)benzimidazol-2-yl]sulfanyl-N-hydroxyacetamide |
| SMILES | O=C(CSc1nc2cc(C(F)(F)F)ccc2n1Cc1ccccc1)NO |
| InChI | InChI=1S/C17H14F3N3O2S/c18-17(19,20)12-6-7-14-13(8-12)21-16(26-10-15(24)22-25)23(14)9-11-4-2-1-3-5-11/h1-8,25H,9-10H2,(H,22,24) |
| InChIKey | WAZXETGTMWSFOA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|