C21H20F3N3OS — CID 112821836
1-[2-[1-benzyl-5-(trifluoromethyl)benzimidazol-2-yl]sulfanylethyl]pyrrolidin-2-one (PubChem CID 112821836) has the molecular formula C21H20F3N3OS and a molecular weight of 419.47 g/mol. Its IUPAC name is 1-[2-[1-benzyl-5-(trifluoromethyl)benzimidazol-2-yl]sulfanylethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[1-benzyl-5-(trifluoromethyl)benzimidazol-2-yl]sulfanylethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 112821836 |
| Molecular Formula | C21H20F3N3OS |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 1-[2-[1-benzyl-5-(trifluoromethyl)benzimidazol-2-yl]sulfanylethyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCSc1nc2cc(C(F)(F)F)ccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C21H20F3N3OS/c22-21(23,24)16-8-9-18-17(13-16)25-20(27(18)14-15-5-2-1-3-6-15)29-12-11-26-10-4-7-19(26)28/h1-3,5-6,8-9,13H,4,7,10-12,14H2 |
| InChIKey | ZREPAACZTHFZOM-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |