C18H16F3N3OS — CID 4815297
2-[1-benzyl-5-(trifluoromethyl)benzimidazol-2-yl]sulfanylpropanamide (PubChem CID 4815297) has the molecular formula C18H16F3N3OS and a molecular weight of 379.41 g/mol. Its IUPAC name is 2-[1-benzyl-5-(trifluoromethyl)benzimidazol-2-yl]sulfanylpropanamide.
| Compound Name | 2-[1-benzyl-5-(trifluoromethyl)benzimidazol-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 4815297 |
| Molecular Formula | C18H16F3N3OS |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 2-[1-benzyl-5-(trifluoromethyl)benzimidazol-2-yl]sulfanylpropanamide |
| SMILES | CC(Sc1nc2cc(C(F)(F)F)ccc2n1Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C18H16F3N3OS/c1-11(16(22)25)26-17-23-14-9-13(18(19,20)21)7-8-15(14)24(17)10-12-5-3-2-4-6-12/h2-9,11H,10H2,1H3,(H2,22,25) |
| InChIKey | VSVHDHDKFNLBJR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |