C21H15F3N4O3S — CID 4843098
2-[1-benzyl-5-(trifluoromethyl)benzimidazol-2-yl]sulfanyl-1-(4-nitro-1H-pyrrol-2-yl)ethanone (PubChem CID 4843098) has the molecular formula C21H15F3N4O3S and a molecular weight of 460.44 g/mol. Its IUPAC name is 2-[1-benzyl-5-(trifluoromethyl)benzimidazol-2-yl]sulfanyl-1-(4-nitro-1H-pyrrol-2-yl)ethanone.
| Compound Name | 2-[1-benzyl-5-(trifluoromethyl)benzimidazol-2-yl]sulfanyl-1-(4-nitro-1H-pyrrol-2-yl)ethanone |
|---|---|
| PubChem CID | 4843098 |
| Molecular Formula | C21H15F3N4O3S |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | 2-[1-benzyl-5-(trifluoromethyl)benzimidazol-2-yl]sulfanyl-1-(4-nitro-1H-pyrrol-2-yl)ethanone |
| SMILES | O=C(CSc1nc2cc(C(F)(F)F)ccc2n1Cc1ccccc1)c1cc([N+](=O)[O-])c[nH]1 |
| InChI | InChI=1S/C21H15F3N4O3S/c22-21(23,24)14-6-7-18-16(8-14)26-20(27(18)11-13-4-2-1-3-5-13)32-12-19(29)17-9-15(10-25-17)28(30)31/h1-10,25H,11-12H2 |
| InChIKey | FIHLZNUGVCTKLD-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|