C24H24N2O3S — CID 4215353
3-butan-2-yl-2-[(7,8-dimethyl-2-oxochromen-4-yl)methylsulfanyl]quinazolin-4-one (PubChem CID 4215353) has the molecular formula C24H24N2O3S and a molecular weight of 420.53 g/mol. Its IUPAC name is 3-butan-2-yl-2-[(7,8-dimethyl-2-oxochromen-4-yl)methylsulfanyl]quinazolin-4-one.
| Compound Name | 3-butan-2-yl-2-[(7,8-dimethyl-2-oxochromen-4-yl)methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 4215353 |
| Molecular Formula | C24H24N2O3S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 3-butan-2-yl-2-[(7,8-dimethyl-2-oxochromen-4-yl)methylsulfanyl]quinazolin-4-one |
| SMILES | CCC(C)n1c(SCc2cc(=O)oc3c(C)c(C)ccc23)nc2ccccc2c1=O |
| InChI | InChI=1S/C24H24N2O3S/c1-5-15(3)26-23(28)19-8-6-7-9-20(19)25-24(26)30-13-17-12-21(27)29-22-16(4)14(2)10-11-18(17)22/h6-12,15H,5,13H2,1-4H3 |
| InChIKey | SZDQGUMFVVKDLI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|