C21H20N4O2S — CID 135766759
3-[(2S)-butan-2-yl]-2-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]quinazolin-4-one (PubChem CID 135766759) has the molecular formula C21H20N4O2S and a molecular weight of 392.48 g/mol. Its IUPAC name is 3-[(2S)-butan-2-yl]-2-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]quinazolin-4-one.
| Compound Name | 3-[(2S)-butan-2-yl]-2-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 135766759 |
| Molecular Formula | C21H20N4O2S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 3-[(2S)-butan-2-yl]-2-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]quinazolin-4-one |
| SMILES | CC[C@H](C)n1c(SCc2nc3ccccc3c(=O)[nH]2)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H20N4O2S/c1-3-13(2)25-20(27)15-9-5-7-11-17(15)23-21(25)28-12-18-22-16-10-6-4-8-14(16)19(26)24-18/h4-11,13H,3,12H2,1-2H3,(H,22,24,26)/t13-/m0/s1 |
| InChIKey | FVGIDBJSSLDLLG-ZDUSSCGKSA-N |
| XLogP | 3.90 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |