C21H20N4O3S — CID 135470968
3-(3-methoxypropyl)-2-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]quinazolin-4-one (PubChem CID 135470968) has the molecular formula C21H20N4O3S and a molecular weight of 408.48 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-2-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]quinazolin-4-one.
| Compound Name | 3-(3-methoxypropyl)-2-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 135470968 |
| Molecular Formula | C21H20N4O3S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 3-(3-methoxypropyl)-2-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]quinazolin-4-one |
| SMILES | COCCCn1c(SCc2nc3ccccc3c(=O)[nH]2)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H20N4O3S/c1-28-12-6-11-25-20(27)15-8-3-5-10-17(15)23-21(25)29-13-18-22-16-9-4-2-7-14(16)19(26)24-18/h2-5,7-10H,6,11-13H2,1H3,(H,22,24,26) |
| InChIKey | GGQUJTQNQGHDAC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|