C26H23N3O3S2 — CID 5199801
3-(3-methoxypropyl)-2-(2-oxo-2-phenothiazin-10-ylethyl)sulfanylquinazolin-4-one (PubChem CID 5199801) has the molecular formula C26H23N3O3S2 and a molecular weight of 489.62 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-2-(2-oxo-2-phenothiazin-10-ylethyl)sulfanylquinazolin-4-one.
| Compound Name | 3-(3-methoxypropyl)-2-(2-oxo-2-phenothiazin-10-ylethyl)sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 5199801 |
| Molecular Formula | C26H23N3O3S2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 3-(3-methoxypropyl)-2-(2-oxo-2-phenothiazin-10-ylethyl)sulfanylquinazolin-4-one |
| SMILES | COCCCn1c(SCC(=O)N2c3ccccc3Sc3ccccc32)nc2ccccc2c1=O |
| InChI | InChI=1S/C26H23N3O3S2/c1-32-16-8-15-28-25(31)18-9-2-3-10-19(18)27-26(28)33-17-24(30)29-20-11-4-6-13-22(20)34-23-14-7-5-12-21(23)29/h2-7,9-14H,8,15-17H2,1H3 |
| InChIKey | VEFQOBOCZUELBD-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|