C19H20N4O5S — CID 7803373
N'-[2-[3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]furan-2-carbohydrazide (PubChem CID 7803373) has the molecular formula C19H20N4O5S and a molecular weight of 416.46 g/mol. Its IUPAC name is N'-[2-[3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]furan-2-carbohydrazide.
| Compound Name | N'-[2-[3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 7803373 |
| Molecular Formula | C19H20N4O5S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | N'-[2-[3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]furan-2-carbohydrazide |
| SMILES | COCCCn1c(SCC(=O)NNC(=O)c2ccco2)nc2ccccc2c1=O |
| InChI | InChI=1S/C19H20N4O5S/c1-27-10-5-9-23-18(26)13-6-2-3-7-14(13)20-19(23)29-12-16(24)21-22-17(25)15-8-4-11-28-15/h2-4,6-8,11H,5,9-10,12H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | ACWATZJMJMMZCR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 115.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|