C26H32N4O4S — CID 42982505
N-[(4-benzylmorpholin-2-yl)methyl]-2-[3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 42982505) has the molecular formula C26H32N4O4S and a molecular weight of 496.63 g/mol. Its IUPAC name is N-[(4-benzylmorpholin-2-yl)methyl]-2-[3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-[(4-benzylmorpholin-2-yl)methyl]-2-[3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 42982505 |
| Molecular Formula | C26H32N4O4S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | N-[(4-benzylmorpholin-2-yl)methyl]-2-[3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | COCCCn1c(SCC(=O)NCC2CN(Cc3ccccc3)CCO2)nc2ccccc2c1=O |
| InChI | InChI=1S/C26H32N4O4S/c1-33-14-7-12-30-25(32)22-10-5-6-11-23(22)28-26(30)35-19-24(31)27-16-21-18-29(13-15-34-21)17-20-8-3-2-4-9-20/h2-6,8-11,21H,7,12-19H2,1H3,(H,27,31) |
| InChIKey | ZUDSUPNJEJPUBT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|