C27H28N4O6S — CID 3181449
N-[4-[[2-[3-(3-ethoxypropyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]amino]-2-methoxyphenyl]furan-2-carboxamide (PubChem CID 3181449) has the molecular formula C27H28N4O6S and a molecular weight of 536.61 g/mol. Its IUPAC name is N-[4-[[2-[3-(3-ethoxypropyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]amino]-2-methoxyphenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[2-[3-(3-ethoxypropyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]amino]-2-methoxyphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3181449 |
| Molecular Formula | C27H28N4O6S |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | N-[4-[[2-[3-(3-ethoxypropyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]amino]-2-methoxyphenyl]furan-2-carboxamide |
| SMILES | CCOCCCn1c(SCC(=O)Nc2ccc(NC(=O)c3ccco3)c(OC)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C27H28N4O6S/c1-3-36-14-7-13-31-26(34)19-8-4-5-9-20(19)30-27(31)38-17-24(32)28-18-11-12-21(23(16-18)35-2)29-25(33)22-10-6-15-37-22/h4-6,8-12,15-16H,3,7,13-14,17H2,1-2H3,(H,28,32)(H,29,33) |
| InChIKey | JBCMRRQXHYPTLB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 124.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|