C22H25N3O3S — CID 2610706
2-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-propan-2-ylphenyl)acetamide (PubChem CID 2610706) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is 2-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 2610706 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 2-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-propan-2-ylphenyl)acetamide |
| SMILES | COCCn1c(SCC(=O)Nc2ccccc2C(C)C)nc2ccccc2c1=O |
| InChI | InChI=1S/C22H25N3O3S/c1-15(2)16-8-4-6-10-18(16)23-20(26)14-29-22-24-19-11-7-5-9-17(19)21(27)25(22)12-13-28-3/h4-11,15H,12-14H2,1-3H3,(H,23,26) |
| InChIKey | BCMQLHHUIJEBLO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |